C29H61NO7Si3 — CID 177443370
tert-butyl (4R)-2-oxo-4-[(1R,2S)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 177443370) has the molecular formula C29H61NO7Si3 and a molecular weight of 620.07 g/mol. Its IUPAC name is tert-butyl (4R)-2-oxo-4-[(1R,2S)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2-oxo-4-[(1R,2S)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 177443370 |
| Molecular Formula | C29H61NO7Si3 |
| Molecular Weight | 620.07 g/mol |
| Exact Mass | 619.38 |
| IUPAC Name | tert-butyl (4R)-2-oxo-4-[(1R,2S)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)OC[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H61NO7Si3/c1-26(2,3)35-25(32)30-21(19-33-24(30)31)23(37-40(17,18)29(10,11)12)22(36-39(15,16)28(7,8)9)20-34-38(13,14)27(4,5)6/h21-23H,19-20H2,1-18H3/t21-,22+,23-/m1/s1 |
| InChIKey | HUNOPBLXZNHTRZ-XPWALMASSA-N |
| XLogP | 8.54 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.07 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|