C20H22N4O6 — CID 177444563
(2R,3S,5R)-2-(hydroxymethyl)-5-[7-nitro-4-(2,4,6-trimethylphenoxy)imidazo[4,5-c]pyridin-1-yl]oxolan-3-ol (PubChem CID 177444563) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is (2R,3S,5R)-2-(hydroxymethyl)-5-[7-nitro-4-(2,4,6-trimethylphenoxy)imidazo[4,5-c]pyridin-1-yl]oxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-(hydroxymethyl)-5-[7-nitro-4-(2,4,6-trimethylphenoxy)imidazo[4,5-c]pyridin-1-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 177444563 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | (2R,3S,5R)-2-(hydroxymethyl)-5-[7-nitro-4-(2,4,6-trimethylphenoxy)imidazo[4,5-c]pyridin-1-yl]oxolan-3-ol |
| SMILES | Cc1cc(C)c(Oc2ncc([N+](=O)[O-])c3c2ncn3[C@H]2C[C@H](O)[C@@H](CO)O2)c(C)c1 |
| InChI | InChI=1S/C20H22N4O6/c1-10-4-11(2)19(12(3)5-10)30-20-17-18(13(7-21-20)24(27)28)23(9-22-17)16-6-14(26)15(8-25)29-16/h4-5,7,9,14-16,25-26H,6,8H2,1-3H3/t14-,15+,16+/m0/s1 |
| InChIKey | PKIBNYFHQGUSQQ-ARFHVFGLSA-N |
| XLogP | 2.70 |
| TPSA | 132.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|