C17H23NO3S — CID 177445708
4-(benzenesulfonyl)-N-[(4Z)-hepta-4,6-dienyl]butan-1-imine oxide (PubChem CID 177445708) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-[(4Z)-hepta-4,6-dienyl]butan-1-imine oxide.
| Compound Name | 4-(benzenesulfonyl)-N-[(4Z)-hepta-4,6-dienyl]butan-1-imine oxide |
|---|---|
| PubChem CID | 177445708 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-(benzenesulfonyl)-N-[(4Z)-hepta-4,6-dienyl]butan-1-imine oxide |
| SMILES | C=C/C=C\CCC/[N+]([O-])=C/CCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H23NO3S/c1-2-3-4-5-9-14-18(19)15-10-11-16-22(20,21)17-12-7-6-8-13-17/h2-4,6-8,12-13,15H,1,5,9-11,14,16H2/b4-3-,18-15- |
| InChIKey | YMJZOHCSHOYFHY-RIYWVADQSA-N |
| XLogP | 3.34 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|