C49H32N4 — CID 177447247
5-(4-cyclopenta-1,2,4-trien-1-ylphenyl)-10,15,20-triphenyl-21,23-dihydroporphyrin (PubChem CID 177447247) has the molecular formula C49H32N4 and a molecular weight of 676.82 g/mol. Its IUPAC name is 5-(4-cyclopenta-1,2,4-trien-1-ylphenyl)-10,15,20-triphenyl-21,23-dihydroporphyrin.
| Compound Name | 5-(4-cyclopenta-1,2,4-trien-1-ylphenyl)-10,15,20-triphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 177447247 |
| Molecular Formula | C49H32N4 |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | 5-(4-cyclopenta-1,2,4-trien-1-ylphenyl)-10,15,20-triphenyl-21,23-dihydroporphyrin |
| SMILES | C1=CC=CC=1c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C49H32N4/c1-4-14-34(15-5-1)46-38-24-26-40(50-38)47(35-16-6-2-7-17-35)42-28-30-44(52-42)49(37-22-20-33(21-23-37)32-12-10-11-13-32)45-31-29-43(53-45)48(36-18-8-3-9-19-36)41-27-25-39(46)51-41/h1-12,14-31,50,53H/b46-38-,46-39-,47-40-,47-42-,48-41-,48-43-,49-44-,49-45- |
| InChIKey | MOSYRLZIZJIGAV-VUXQGAMNSA-N |
| XLogP | 12.43 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |