About dipotassium;dioxido(oxo)germane
dipotassium;dioxido(oxo)germane (PubChem CID 177448406) has the molecular formula GeK2O3
and a molecular weight of 198.80 g/mol. Its IUPAC name is dipotassium;dioxido(oxo)germane.
Molecular Properties
| Compound Name | dipotassium;dioxido(oxo)germane |
| PubChem CID | 177448406 |
| Molecular Formula | GeK2O3 |
| Molecular Weight | 198.80 g/mol |
| Exact Mass | 199.83 |
| IUPAC Name | dipotassium;dioxido(oxo)germane |
| SMILES | O=[Ge]([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/GeO3.2K/c2-1(3)4;;/q-2;2*+1 |
| InChIKey | BHVXGCGFVAONBO-UHFFFAOYSA-N |
| XLogP | -8.87 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.80 |
| LogP ≤ 5 | -8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dipotassium;dioxido(oxo)germane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;dioxido(oxo)germane?
The IUPAC name of dipotassium;dioxido(oxo)germane (CID 177448406) is dipotassium;dioxido(oxo)germane.
What is the SMILES notation for dipotassium;dioxido(oxo)germane?
The canonical SMILES for dipotassium;dioxido(oxo)germane is O=[Ge]([O-])[O-].[K+].[K+].
What is the InChIKey of dipotassium;dioxido(oxo)germane?
The InChIKey is BHVXGCGFVAONBO-UHFFFAOYSA-N. The full InChI is InChI=1S/GeO3.2K/c2-1(3)4;;/q-2;2*+1.
What are the key properties of dipotassium;dioxido(oxo)germane?
dipotassium;dioxido(oxo)germane has a molecular weight of 198.80 g/mol, XLogP of -8.87, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;dioxido(oxo)germane is sourced from PubChem (CID 177448406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).