About dioxido(oxo)germane;bis(thallium(1+))
dioxido(oxo)germane;bis(thallium(1+)) (PubChem CID 19101534) has the molecular formula GeO3Tl2
and a molecular weight of 529.37 g/mol. Its IUPAC name is dioxido(oxo)germane;bis(thallium(1+)).
Molecular Properties
| Compound Name | dioxido(oxo)germane;bis(thallium(1+)) |
| PubChem CID | 19101534 |
| Molecular Formula | GeO3Tl2 |
| Molecular Weight | 529.37 g/mol |
| Exact Mass | 531.85 |
| IUPAC Name | dioxido(oxo)germane;bis(thallium(1+)) |
| SMILES | O=[Ge]([O-])[O-].[Tl+].[Tl+] |
| InChI | InChI=1S/GeO3.2Tl/c2-1(3)4;;/q-2;2*+1 |
| InChIKey | ZTKFPFQTYKMCCU-UHFFFAOYSA-N |
| XLogP | -3.64 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 529.37 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dioxido(oxo)germane;bis(thallium(1+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)germane;bis(thallium(1+))?
The IUPAC name of dioxido(oxo)germane;bis(thallium(1+)) (CID 19101534) is dioxido(oxo)germane;bis(thallium(1+)).
What is the SMILES notation for dioxido(oxo)germane;bis(thallium(1+))?
The canonical SMILES for dioxido(oxo)germane;bis(thallium(1+)) is O=[Ge]([O-])[O-].[Tl+].[Tl+].
What is the InChIKey of dioxido(oxo)germane;bis(thallium(1+))?
The InChIKey is ZTKFPFQTYKMCCU-UHFFFAOYSA-N. The full InChI is InChI=1S/GeO3.2Tl/c2-1(3)4;;/q-2;2*+1.
What are the key properties of dioxido(oxo)germane;bis(thallium(1+))?
dioxido(oxo)germane;bis(thallium(1+)) has a molecular weight of 529.37 g/mol, XLogP of -3.64, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)germane;bis(thallium(1+)) is sourced from PubChem (CID 19101534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).