C14H16K2O — CID 177449036
dipotassium;3,4,4-trimethyl-1-phenylpent-1-yn-3-olate (PubChem CID 177449036) has the molecular formula C14H16K2O and a molecular weight of 278.48 g/mol. Its IUPAC name is dipotassium;3,4,4-trimethyl-1-phenylpent-1-yn-3-olate.
| Compound Name | dipotassium;3,4,4-trimethyl-1-phenylpent-1-yn-3-olate |
|---|---|
| PubChem CID | 177449036 |
| Molecular Formula | C14H16K2O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | dipotassium;3,4,4-trimethyl-1-phenylpent-1-yn-3-olate |
| SMILES | CC(C)(C)C(C)([O-])C#Cc1c[c-]ccc1.[K+].[K+] |
| InChI | InChI=1S/C14H16O.2K/c1-13(2,3)14(4,15)11-10-12-8-6-5-7-9-12;;/h5-6,8-9H,1-4H3;;/q-2;2*+1 |
| InChIKey | XFGBXSLWBRRCNF-UHFFFAOYSA-N |
| XLogP | -3.99 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|