C12H13W- — CID 156800823
3,3-dimethylbut-1-ynylbenzene;tungsten (PubChem CID 156800823) has the molecular formula C12H13W- and a molecular weight of 341.08 g/mol. Its IUPAC name is 3,3-dimethylbut-1-ynylbenzene;tungsten.
| Compound Name | 3,3-dimethylbut-1-ynylbenzene;tungsten |
|---|---|
| PubChem CID | 156800823 |
| Molecular Formula | C12H13W- |
| Molecular Weight | 341.08 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 3,3-dimethylbut-1-ynylbenzene;tungsten |
| SMILES | CC(C)(C)C#Cc1c[c-]ccc1.[W] |
| InChI | InChI=1S/C12H13.W/c1-12(2,3)10-9-11-7-5-4-6-8-11;/h4-5,7-8H,1-3H3;/q-1; |
| InChIKey | VQDWBIBAIGNQLX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.08 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|