C42H48N2O7 — CID 177449777
methyl (12Z)-21-acetamido-18-(4-aminobutyl)-31,32-dimethoxy-17,20-dioxopentacyclo[21.7.1.12,10.03,8.025,30]dotriaconta-1(31),2(32),3,5,7,9,12,23,25,27,29-undecaene-15-carboxylate (PubChem CID 177449777) has the molecular formula C42H48N2O7 and a molecular weight of 692.85 g/mol. Its IUPAC name is methyl (12Z)-21-acetamido-18-(4-aminobutyl)-31,32-dimethoxy-17,20-dioxopentacyclo[21.7.1.12,10.03,8.025,30]dotriaconta-1(31),2(32),3,5,7,9,12,23,25,27,29-undecaene-15-carboxylate.
| Compound Name | methyl (12Z)-21-acetamido-18-(4-aminobutyl)-31,32-dimethoxy-17,20-dioxopentacyclo[21.7.1.12,10.03,8.025,30]dotriaconta-1(31),2(32),3,5,7,9,12,23,25,27,29-undecaene-15-carboxylate |
|---|---|
| PubChem CID | 177449777 |
| Molecular Formula | C42H48N2O7 |
| Molecular Weight | 692.85 g/mol |
| Exact Mass | 692.35 |
| IUPAC Name | methyl (12Z)-21-acetamido-18-(4-aminobutyl)-31,32-dimethoxy-17,20-dioxopentacyclo[21.7.1.12,10.03,8.025,30]dotriaconta-1(31),2(32),3,5,7,9,12,23,25,27,29-undecaene-15-carboxylate |
| SMILES | COC(=O)C1C/C=C\Cc2cc3ccccc3c(c2OC)-c2c(OC)c(cc3ccccc23)CC(NC(C)=O)C(=O)CC(CCCCN)C(=O)C1 |
| InChI | InChI=1S/C42H48N2O7/c1-26(45)44-35-23-32-22-28-14-8-10-19-34(28)39(41(32)50-3)38-33-18-9-7-13-27(33)21-30(40(38)49-2)16-5-6-17-31(42(48)51-4)25-36(46)29(24-37(35)47)15-11-12-20-43/h5-10,13-14,18-19,21-22,29,31,35H,11-12,15-17,20,23-25,43H2,1-4H3,(H,44,45)/b6-5- |
| InChIKey | WWDVZGYNHKVIAS-WAYWQWQTSA-N |
| XLogP | 6.68 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.85 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|