C17H15F3O2 — CID 177454305
1-methoxy-4-[(E)-4,4,4-trifluoro-1-phenylbut-2-enoxy]benzene (PubChem CID 177454305) has the molecular formula C17H15F3O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is 1-methoxy-4-[(E)-4,4,4-trifluoro-1-phenylbut-2-enoxy]benzene.
| Compound Name | 1-methoxy-4-[(E)-4,4,4-trifluoro-1-phenylbut-2-enoxy]benzene |
|---|---|
| PubChem CID | 177454305 |
| Molecular Formula | C17H15F3O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-methoxy-4-[(E)-4,4,4-trifluoro-1-phenylbut-2-enoxy]benzene |
| SMILES | COc1ccc(OC(/C=C/C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H15F3O2/c1-21-14-7-9-15(10-8-14)22-16(11-12-17(18,19)20)13-5-3-2-4-6-13/h2-12,16H,1H3/b12-11+ |
| InChIKey | OYUWWOGIFDPPDF-VAWYXSNFSA-N |
| XLogP | 4.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|