C41H54I2N4O11 — CID 177454365
2,6-bis[2-[4-[2-[bis(2-methoxyethoxy)amino]ethoxy]-6-iodo-2-pyridinyl]ethynyl]-4-pentylphenol (PubChem CID 177454365) has the molecular formula C41H54I2N4O11 and a molecular weight of 1032.71 g/mol. Its IUPAC name is 2,6-bis[2-[4-[2-[bis(2-methoxyethoxy)amino]ethoxy]-6-iodo-2-pyridinyl]ethynyl]-4-pentylphenol.
| Compound Name | 2,6-bis[2-[4-[2-[bis(2-methoxyethoxy)amino]ethoxy]-6-iodo-2-pyridinyl]ethynyl]-4-pentylphenol |
|---|---|
| PubChem CID | 177454365 |
| Molecular Formula | C41H54I2N4O11 |
| Molecular Weight | 1032.71 g/mol |
| Exact Mass | 1032.19 |
| IUPAC Name | 2,6-bis[2-[4-[2-[bis(2-methoxyethoxy)amino]ethoxy]-6-iodo-2-pyridinyl]ethynyl]-4-pentylphenol |
| SMILES | CCCCCc1cc(C#Cc2cc(OCCN(OCCOC)OCCOC)cc(I)n2)c(O)c(C#Cc2cc(OCCN(OCCOC)OCCOC)cc(I)n2)c1 |
| InChI | InChI=1S/C41H54I2N4O11/c1-6-7-8-9-32-26-33(10-12-35-28-37(30-39(42)44-35)53-16-14-46(55-22-18-49-2)56-23-19-50-3)41(48)34(27-32)11-13-36-29-38(31-40(43)45-36)54-17-15-47(57-24-20-51-4)58-25-21-52-5/h26-31,48H,6-9,14-25H2,1-5H3 |
| InChIKey | CEDIQCHXDNIYAG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1032.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|