C22H15F2N — CID 177457311
2,4-bis(3-fluorophenyl)-1-phenylpyrrole (PubChem CID 177457311) has the molecular formula C22H15F2N and a molecular weight of 331.37 g/mol. Its IUPAC name is 2,4-bis(3-fluorophenyl)-1-phenylpyrrole.
| Compound Name | 2,4-bis(3-fluorophenyl)-1-phenylpyrrole |
|---|---|
| PubChem CID | 177457311 |
| Molecular Formula | C22H15F2N |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2,4-bis(3-fluorophenyl)-1-phenylpyrrole |
| SMILES | Fc1cccc(-c2cc(-c3cccc(F)c3)n(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C22H15F2N/c23-19-8-4-6-16(12-19)18-14-22(17-7-5-9-20(24)13-17)25(15-18)21-10-2-1-3-11-21/h1-15H |
| InChIKey | DKDJIBPLJJJYCO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |