C29H40O9 — CID 177458723
[(1S,2S,5R,6R,7S,8S,9R,10R,12S,13R,15S)-6-acetyloxy-7-hydroxy-9-(hydroxymethyl)-4,5,7,10,14,14-hexamethyl-18-oxo-19,20-dioxahexacyclo[10.5.2.12,8.01,13.02,10.05,9]icos-3-en-15-yl] acetate (PubChem CID 177458723) has the molecular formula C29H40O9 and a molecular weight of 532.63 g/mol. Its IUPAC name is [(1S,2S,5R,6R,7S,8S,9R,10R,12S,13R,15S)-6-acetyloxy-7-hydroxy-9-(hydroxymethyl)-4,5,7,10,14,14-hexamethyl-18-oxo-19,20-dioxahexacyclo[10.5.2.12,8.01,13.02,10.05,9]icos-3-en-15-yl] acetate.
| Compound Name | [(1S,2S,5R,6R,7S,8S,9R,10R,12S,13R,15S)-6-acetyloxy-7-hydroxy-9-(hydroxymethyl)-4,5,7,10,14,14-hexamethyl-18-oxo-19,20-dioxahexacyclo[10.5.2.12,8.01,13.02,10.05,9]icos-3-en-15-yl] acetate |
|---|---|
| PubChem CID | 177458723 |
| Molecular Formula | C29H40O9 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | [(1S,2S,5R,6R,7S,8S,9R,10R,12S,13R,15S)-6-acetyloxy-7-hydroxy-9-(hydroxymethyl)-4,5,7,10,14,14-hexamethyl-18-oxo-19,20-dioxahexacyclo[10.5.2.12,8.01,13.02,10.05,9]icos-3-en-15-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]23C(=O)O[C@@H](C[C@@]4(C)[C@@]25C=C(C)[C@@]2(C)[C@@H](OC(C)=O)[C@@](C)(O)[C@@H](O5)[C@@]42CO)[C@@H]3C1(C)C |
| InChI | InChI=1S/C29H40O9/c1-14-11-29-24(6,28(13-30)21(38-29)26(8,34)20(25(14,28)7)36-16(3)32)12-17-19-23(4,5)18(35-15(2)31)9-10-27(19,29)22(33)37-17/h11,17-21,30,34H,9-10,12-13H2,1-8H3/t17-,18-,19+,20+,21+,24+,25-,26+,27+,28-,29-/m0/s1 |
| InChIKey | LCMLUEPHSGCXCA-LXVWSLGKSA-N |
| XLogP | 2.45 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|