C8H14N2O2S2 — CID 177459584
2,2-bis(methylsulfanyl)ethenyl-oxido-[(2S)-3-oxobutan-2-yl]iminoazanium (PubChem CID 177459584) has the molecular formula C8H14N2O2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is 2,2-bis(methylsulfanyl)ethenyl-oxido-[(2S)-3-oxobutan-2-yl]iminoazanium.
| Compound Name | 2,2-bis(methylsulfanyl)ethenyl-oxido-[(2S)-3-oxobutan-2-yl]iminoazanium |
|---|---|
| PubChem CID | 177459584 |
| Molecular Formula | C8H14N2O2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2,2-bis(methylsulfanyl)ethenyl-oxido-[(2S)-3-oxobutan-2-yl]iminoazanium |
| SMILES | CSC(=C/[N+]([O-])=N/[C@@H](C)C(C)=O)SC |
| InChI | InChI=1S/C8H14N2O2S2/c1-6(7(2)11)9-10(12)5-8(13-3)14-4/h5-6H,1-4H3/b10-9-/t6-/m0/s1 |
| InChIKey | GZLSNWYZDKNHQD-LLKXKLLRSA-N |
| XLogP | 2.45 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|