C10H17NO2S2 — CID 159481124
1,1-bis(methylsulfanyl)-2-nitroethene;methane;tricyclo[2.1.0.01,3]pentane (PubChem CID 159481124) has the molecular formula C10H17NO2S2 and a molecular weight of 247.38 g/mol. Its IUPAC name is 1,1-bis(methylsulfanyl)-2-nitroethene;methane;tricyclo[2.1.0.01,3]pentane.
| Compound Name | 1,1-bis(methylsulfanyl)-2-nitroethene;methane;tricyclo[2.1.0.01,3]pentane |
|---|---|
| PubChem CID | 159481124 |
| Molecular Formula | C10H17NO2S2 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 1,1-bis(methylsulfanyl)-2-nitroethene;methane;tricyclo[2.1.0.01,3]pentane |
| SMILES | C.C1C2C3CC123.CSC(=C[N+](=O)[O-])SC |
| InChI | InChI=1S/C5H6.C4H7NO2S2.CH4/c1-3-4-2-5(1,3)4;1-8-4(9-2)3-5(6)7;/h3-4H,1-2H2;3H,1-2H3;1H4 |
| InChIKey | LXABCKPYMYVWQJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|