C22H34O4 — CID 177460703
(E,2S)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]-6-[(2R,5S)-5-ethenyl-5-methyloxolan-2-yl]oxy-6-methylhept-4-en-3-one (PubChem CID 177460703) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (E,2S)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]-6-[(2R,5S)-5-ethenyl-5-methyloxolan-2-yl]oxy-6-methylhept-4-en-3-one.
| Compound Name | (E,2S)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]-6-[(2R,5S)-5-ethenyl-5-methyloxolan-2-yl]oxy-6-methylhept-4-en-3-one |
|---|---|
| PubChem CID | 177460703 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (E,2S)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]-6-[(2R,5S)-5-ethenyl-5-methyloxolan-2-yl]oxy-6-methylhept-4-en-3-one |
| SMILES | C=C[C@@]1(C)CC[C@@H]([C@H](C)C(=O)/C=C/C(C)(C)O[C@H]2CC[C@@](C)(C=C)O2)O1 |
| InChI | InChI=1S/C22H34O4/c1-8-21(6)14-11-18(24-21)16(3)17(23)10-13-20(4,5)25-19-12-15-22(7,9-2)26-19/h8-10,13,16,18-19H,1-2,11-12,14-15H2,3-7H3/b13-10+/t16-,18+,19-,21+,22-/m1/s1 |
| InChIKey | VZMZUFOZLVHVLP-AHOIRNMHSA-N |
| XLogP | 4.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|