C19H16N2O — CID 177460803
1-(5,8-dimethylindolo[2,3-b]quinolin-2-yl)ethanone (PubChem CID 177460803) has the molecular formula C19H16N2O and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-(5,8-dimethylindolo[2,3-b]quinolin-2-yl)ethanone.
| Compound Name | 1-(5,8-dimethylindolo[2,3-b]quinolin-2-yl)ethanone |
|---|---|
| PubChem CID | 177460803 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-(5,8-dimethylindolo[2,3-b]quinolin-2-yl)ethanone |
| SMILES | CC(=O)c1ccc2c(c1)cc1c3ccc(C)cc3nc-1n2C |
| InChI | InChI=1S/C19H16N2O/c1-11-4-6-15-16-10-14-9-13(12(2)22)5-7-18(14)21(3)19(16)20-17(15)8-11/h4-10H,1-3H3 |
| InChIKey | ZEQNOMRSQNYDET-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |