C21H20N2O2 — CID 177462049
(2R)-N-(4-tert-butylphenyl)-2-cyano-3-oxo-1H-indene-2-carboxamide (PubChem CID 177462049) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is (2R)-N-(4-tert-butylphenyl)-2-cyano-3-oxo-1H-indene-2-carboxamide.
| Compound Name | (2R)-N-(4-tert-butylphenyl)-2-cyano-3-oxo-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 177462049 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (2R)-N-(4-tert-butylphenyl)-2-cyano-3-oxo-1H-indene-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)[C@@]2(C#N)Cc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H20N2O2/c1-20(2,3)15-8-10-16(11-9-15)23-19(25)21(13-22)12-14-6-4-5-7-17(14)18(21)24/h4-11H,12H2,1-3H3,(H,23,25)/t21-/m1/s1 |
| InChIKey | XYHGDSUEEQABRM-OAQYLSRUSA-N |
| XLogP | 3.87 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|