C21H19BrN2O2 — CID 177491876
(2R)-6-bromo-N-(4-tert-butylphenyl)-2-cyano-3-oxo-1H-indene-2-carboxamide (PubChem CID 177491876) has the molecular formula C21H19BrN2O2 and a molecular weight of 411.30 g/mol. Its IUPAC name is (2R)-6-bromo-N-(4-tert-butylphenyl)-2-cyano-3-oxo-1H-indene-2-carboxamide.
| Compound Name | (2R)-6-bromo-N-(4-tert-butylphenyl)-2-cyano-3-oxo-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 177491876 |
| Molecular Formula | C21H19BrN2O2 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | (2R)-6-bromo-N-(4-tert-butylphenyl)-2-cyano-3-oxo-1H-indene-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)[C@@]2(C#N)Cc3cc(Br)ccc3C2=O)cc1 |
| InChI | InChI=1S/C21H19BrN2O2/c1-20(2,3)14-4-7-16(8-5-14)24-19(26)21(12-23)11-13-10-15(22)6-9-17(13)18(21)25/h4-10H,11H2,1-3H3,(H,24,26)/t21-/m1/s1 |
| InChIKey | KCDQZQFMZJDAML-OAQYLSRUSA-N |
| XLogP | 4.63 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|