C19H21N3O3 — CID 177462492
ethyl (3E)-2-benzamido-3-[(4-methylphenyl)hydrazinylidene]propanoate (PubChem CID 177462492) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is ethyl (3E)-2-benzamido-3-[(4-methylphenyl)hydrazinylidene]propanoate.
| Compound Name | ethyl (3E)-2-benzamido-3-[(4-methylphenyl)hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 177462492 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | ethyl (3E)-2-benzamido-3-[(4-methylphenyl)hydrazinylidene]propanoate |
| SMILES | CCOC(=O)C(/C=N/Nc1ccc(C)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O3/c1-3-25-19(24)17(21-18(23)15-7-5-4-6-8-15)13-20-22-16-11-9-14(2)10-12-16/h4-13,17,22H,3H2,1-2H3,(H,21,23)/b20-13+ |
| InChIKey | PFAWMZMKSGJPEX-DEDYPNTBSA-N |
| XLogP | 2.75 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|