C34H34F34NO6P — CID 177464075
1,3-bis[(E)-6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridec-4-enoxy]propan-2-yl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 177464075) has the molecular formula C34H34F34NO6P and a molecular weight of 1229.55 g/mol. Its IUPAC name is 1,3-bis[(E)-6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridec-4-enoxy]propan-2-yl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | 1,3-bis[(E)-6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridec-4-enoxy]propan-2-yl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 177464075 |
| Molecular Formula | C34H34F34NO6P |
| Molecular Weight | 1229.55 g/mol |
| Exact Mass | 1229.16 |
| IUPAC Name | 1,3-bis[(E)-6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridec-4-enoxy]propan-2-yl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OC(COCCC/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)COCCC/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C34H34F34NO6P/c1-69(2,3)12-15-74-76(70,71)75-18(16-72-13-8-4-6-10-19(35,36)21(39,40)23(43,44)25(47,48)27(51,52)29(55,56)31(59,60)33(63,64)65)17-73-14-9-5-7-11-20(37,38)22(41,42)24(45,46)26(49,50)28(53,54)30(57,58)32(61,62)34(66,67)68/h6-7,10-11,18H,4-5,8-9,12-17H2,1-3H3/b10-6+,11-7+ |
| InChIKey | JNJGZLFLURIKEX-JMQWPVDRSA-N |
| XLogP | 13.29 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1229.55 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|