C10H13LiO4 — CID 177464290
lithium 1,4-dimethoxy-2-(methoxymethoxy)benzene-3-ide (PubChem CID 177464290) has the molecular formula C10H13LiO4 and a molecular weight of 204.15 g/mol. Its IUPAC name is lithium 1,4-dimethoxy-2-(methoxymethoxy)benzene-3-ide.
| Compound Name | lithium 1,4-dimethoxy-2-(methoxymethoxy)benzene-3-ide |
|---|---|
| PubChem CID | 177464290 |
| Molecular Formula | C10H13LiO4 |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | lithium 1,4-dimethoxy-2-(methoxymethoxy)benzene-3-ide |
| SMILES | COCOc1[c-]c(OC)ccc1OC.[Li+] |
| InChI | InChI=1S/C10H13O4.Li/c1-11-7-14-10-6-8(12-2)4-5-9(10)13-3;/h4-5H,7H2,1-3H3;/q-1;+1 |
| InChIKey | JNZOFPHHUUTASO-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|