About lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide
lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide (PubChem CID 10402707) has the molecular formula C15H22LiNO5
and a molecular weight of 303.28 g/mol. Its IUPAC name is lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide.
Molecular Properties
| Compound Name | lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide |
| PubChem CID | 10402707 |
| Molecular Formula | C15H22LiNO5 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide |
| SMILES | CCN(CC)C(=O)c1[c-]c(OCOC)c(OCOC)cc1.[Li+] |
| InChI | InChI=1S/C15H22NO5.Li/c1-5-16(6-2)15(17)12-7-8-13(20-10-18-3)14(9-12)21-11-19-4;/h7-8H,5-6,10-11H2,1-4H3;/q-1;+1 |
| InChIKey | DTLHEZKJGMSCEY-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide?
The IUPAC name of lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide (CID 10402707) is lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide.
What is the SMILES notation for lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide?
The canonical SMILES for lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide is CCN(CC)C(=O)c1[c-]c(OCOC)c(OCOC)cc1.[Li+].
What is the InChIKey of lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide?
The InChIKey is DTLHEZKJGMSCEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22NO5.Li/c1-5-16(6-2)15(17)12-7-8-13(20-10-18-3)14(9-12)21-11-19-4;/h7-8H,5-6,10-11H2,1-4H3;/q-1;+1.
What are the key properties of lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide?
lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide has a molecular weight of 303.28 g/mol, XLogP of -1.06, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium N,N-diethyl-3,4-bis(methoxymethoxy)benzene-2-ide-1-carboxamide is sourced from PubChem (CID 10402707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).