C12H16CuNO — CID 134858453
copper(1+);N,N-diethyl-4-methylbenzene-6-ide-1-carboxamide (PubChem CID 134858453) has the molecular formula C12H16CuNO and a molecular weight of 253.81 g/mol. Its IUPAC name is copper(1+);N,N-diethyl-4-methylbenzene-6-ide-1-carboxamide.
| Compound Name | copper(1+);N,N-diethyl-4-methylbenzene-6-ide-1-carboxamide |
|---|---|
| PubChem CID | 134858453 |
| Molecular Formula | C12H16CuNO |
| Molecular Weight | 253.81 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | copper(1+);N,N-diethyl-4-methylbenzene-6-ide-1-carboxamide |
| SMILES | CCN(CC)C(=O)c1[c-]cc(C)cc1.[Cu+] |
| InChI | InChI=1S/C12H16NO.Cu/c1-4-13(5-2)12(14)11-8-6-10(3)7-9-11;/h6-8H,4-5H2,1-3H3;/q-1;+1 |
| InChIKey | PWLMQLNABWIBQH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.81 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|