C20H22BrIN2O+2 — CID 177464801
(4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium (PubChem CID 177464801) has the molecular formula C20H22BrIN2O+2 and a molecular weight of 513.22 g/mol. Its IUPAC name is (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium.
| Compound Name | (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium |
|---|---|
| PubChem CID | 177464801 |
| Molecular Formula | C20H22BrIN2O+2 |
| Molecular Weight | 513.22 g/mol |
| Exact Mass | 511.99 |
| IUPAC Name | (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium |
| SMILES | Cc1n(CCCOc2ccc([I+]c3ccc(Br)cc3)cc2)cc[n+]1C |
| InChI | InChI=1S/C20H22BrIN2O/c1-16-23(2)13-14-24(16)12-3-15-25-20-10-8-19(9-11-20)22-18-6-4-17(21)5-7-18/h4-11,13-14H,3,12,15H2,1-2H3/q+2 |
| InChIKey | ZNIVRFDNQQRIRQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|