About (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium
(4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium (PubChem CID 177464801) has the molecular formula C20H22BrIN2O+2
and a molecular weight of 513.22 g/mol. Its IUPAC name is (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium.
Molecular Properties
| Compound Name | (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium |
| PubChem CID | 177464801 |
| Molecular Formula | C20H22BrIN2O+2 |
| Molecular Weight | 513.22 g/mol |
| Exact Mass | 511.99 |
| IUPAC Name | (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium |
| SMILES | Cc1n(CCCOc2ccc([I+]c3ccc(Br)cc3)cc2)cc[n+]1C |
| InChI | InChI=1S/C20H22BrIN2O/c1-16-23(2)13-14-24(16)12-3-15-25-20-10-8-19(9-11-20)22-18-6-4-17(21)5-7-18/h4-11,13-14H,3,12,15H2,1-2H3/q+2 |
| InChIKey | ZNIVRFDNQQRIRQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium?
The IUPAC name of (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium (CID 177464801) is (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium.
What is the SMILES notation for (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium?
The canonical SMILES for (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium is Cc1n(CCCOc2ccc([I+]c3ccc(Br)cc3)cc2)cc[n+]1C.
What is the InChIKey of (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium?
The InChIKey is ZNIVRFDNQQRIRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22BrIN2O/c1-16-23(2)13-14-24(16)12-3-15-25-20-10-8-19(9-11-20)22-18-6-4-17(21)5-7-18/h4-11,13-14H,3,12,15H2,1-2H3/q+2.
What are the key properties of (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium?
(4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium has a molecular weight of 513.22 g/mol, XLogP of 0.98, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)-[4-[3-(2,3-dimethylimidazol-3-ium-1-yl)propoxy]phenyl]iodanium is sourced from PubChem (CID 177464801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).