C20H26OS — CID 177465028
(1S,3aS,6aS)-6a-cyclopentyl-1-phenylsulfanyl-1,2,3,4,5,6-hexahydropentalene-3a-carbaldehyde (PubChem CID 177465028) has the molecular formula C20H26OS and a molecular weight of 314.49 g/mol. Its IUPAC name is (1S,3aS,6aS)-6a-cyclopentyl-1-phenylsulfanyl-1,2,3,4,5,6-hexahydropentalene-3a-carbaldehyde.
| Compound Name | (1S,3aS,6aS)-6a-cyclopentyl-1-phenylsulfanyl-1,2,3,4,5,6-hexahydropentalene-3a-carbaldehyde |
|---|---|
| PubChem CID | 177465028 |
| Molecular Formula | C20H26OS |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (1S,3aS,6aS)-6a-cyclopentyl-1-phenylsulfanyl-1,2,3,4,5,6-hexahydropentalene-3a-carbaldehyde |
| SMILES | O=C[C@]12CCC[C@@]1(C1CCCC1)[C@@H](Sc1ccccc1)CC2 |
| InChI | InChI=1S/C20H26OS/c21-15-19-12-6-13-20(19,16-7-4-5-8-16)18(11-14-19)22-17-9-2-1-3-10-17/h1-3,9-10,15-16,18H,4-8,11-14H2/t18-,19+,20+/m0/s1 |
| InChIKey | AUXOYRJEANRZLL-XUVXKRRUSA-N |
| XLogP | 5.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|