C14H15NO3S2 — CID 177465395
N-[(1R)-2-(benzenesulfonyl)-1-thiophen-2-ylethyl]acetamide (PubChem CID 177465395) has the molecular formula C14H15NO3S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[(1R)-2-(benzenesulfonyl)-1-thiophen-2-ylethyl]acetamide.
| Compound Name | N-[(1R)-2-(benzenesulfonyl)-1-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 177465395 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | N-[(1R)-2-(benzenesulfonyl)-1-thiophen-2-ylethyl]acetamide |
| SMILES | CC(=O)N[C@H](CS(=O)(=O)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C14H15NO3S2/c1-11(16)15-13(14-8-5-9-19-14)10-20(17,18)12-6-3-2-4-7-12/h2-9,13H,10H2,1H3,(H,15,16)/t13-/m1/s1 |
| InChIKey | XHDJKFKGUFXQHN-CYBMUJFWSA-N |
| XLogP | 2.40 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |