C17H21N3O4S2 — CID 55985097
3-acetamido-N-[2-(dimethylsulfamoyl)phenyl]-3-thiophen-2-ylpropanamide (PubChem CID 55985097) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 3-acetamido-N-[2-(dimethylsulfamoyl)phenyl]-3-thiophen-2-ylpropanamide.
| Compound Name | 3-acetamido-N-[2-(dimethylsulfamoyl)phenyl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 55985097 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 3-acetamido-N-[2-(dimethylsulfamoyl)phenyl]-3-thiophen-2-ylpropanamide |
| SMILES | CC(=O)NC(CC(=O)Nc1ccccc1S(=O)(=O)N(C)C)c1cccs1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-12(21)18-14(15-8-6-10-25-15)11-17(22)19-13-7-4-5-9-16(13)26(23,24)20(2)3/h4-10,14H,11H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | CNVITQLERMNKOT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |