C16H13F12O2P — CID 177465424
9-tert-butyl-2,2,6,6-tetrakis(trifluoromethyl)-3,5-dioxa-4-phosphatricyclo[5.3.1.04,11]undeca-1(10),8-diene (PubChem CID 177465424) has the molecular formula C16H13F12O2P and a molecular weight of 496.23 g/mol. Its IUPAC name is 9-tert-butyl-2,2,6,6-tetrakis(trifluoromethyl)-3,5-dioxa-4-phosphatricyclo[5.3.1.04,11]undeca-1(10),8-diene.
| Compound Name | 9-tert-butyl-2,2,6,6-tetrakis(trifluoromethyl)-3,5-dioxa-4-phosphatricyclo[5.3.1.04,11]undeca-1(10),8-diene |
|---|---|
| PubChem CID | 177465424 |
| Molecular Formula | C16H13F12O2P |
| Molecular Weight | 496.23 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 9-tert-butyl-2,2,6,6-tetrakis(trifluoromethyl)-3,5-dioxa-4-phosphatricyclo[5.3.1.04,11]undeca-1(10),8-diene |
| SMILES | CC(C)(C)C1=CC2C3C(=C1)C(C(F)(F)F)(C(F)(F)F)OP3OC2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H13F12O2P/c1-10(2,3)6-4-7-9-8(5-6)12(15(23,24)25,16(26,27)28)30-31(9)29-11(7,13(17,18)19)14(20,21)22/h4-5,7,9H,1-3H3 |
| InChIKey | YGRDDJFAMALBIR-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.23 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|