C16H11F12O4S- — CID 3898815
9-tert-butyl-4-oxido-2,2,6,6-tetrakis(trifluoromethyl)-3,5-dioxa-4λ6-thiatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene 4-oxide (PubChem CID 3898815) has the molecular formula C16H11F12O4S- and a molecular weight of 527.30 g/mol. Its IUPAC name is 9-tert-butyl-4-oxido-2,2,6,6-tetrakis(trifluoromethyl)-3,5-dioxa-4λ6-thiatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene 4-oxide.
| Compound Name | 9-tert-butyl-4-oxido-2,2,6,6-tetrakis(trifluoromethyl)-3,5-dioxa-4λ6-thiatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene 4-oxide |
|---|---|
| PubChem CID | 3898815 |
| Molecular Formula | C16H11F12O4S- |
| Molecular Weight | 527.30 g/mol |
| Exact Mass | 527.02 |
| IUPAC Name | 9-tert-butyl-4-oxido-2,2,6,6-tetrakis(trifluoromethyl)-3,5-dioxa-4λ6-thiatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-triene 4-oxide |
| SMILES | CC(C)(C)c1cc2c3c(c1)C(C(F)(F)F)(C(F)(F)F)OS3(=O)([O-])OC2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H12F12O4S/c1-10(2,3)6-4-7-9-8(5-6)12(15(23,24)25,16(26,27)28)32-33(9,29,30)31-11(7,13(17,18)19)14(20,21)22/h4-5H,1-3H3,(H,29,30)/p-1 |
| InChIKey | IOKOEAYDFSXSQD-UHFFFAOYSA-M |
| XLogP | 5.82 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.30 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |