C26H30F6O2Se — CID 167545577
5,5'-ditert-butyl-3,3'-dimethyl-3,3'-bis(trifluoromethyl)-1,1'-spirobi[2,1λ4-benzoxaselenole] (PubChem CID 167545577) has the molecular formula C26H30F6O2Se and a molecular weight of 567.47 g/mol. Its IUPAC name is 5,5'-ditert-butyl-3,3'-dimethyl-3,3'-bis(trifluoromethyl)-1,1'-spirobi[2,1λ4-benzoxaselenole].
| Compound Name | 5,5'-ditert-butyl-3,3'-dimethyl-3,3'-bis(trifluoromethyl)-1,1'-spirobi[2,1λ4-benzoxaselenole] |
|---|---|
| PubChem CID | 167545577 |
| Molecular Formula | C26H30F6O2Se |
| Molecular Weight | 567.47 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | 5,5'-ditert-butyl-3,3'-dimethyl-3,3'-bis(trifluoromethyl)-1,1'-spirobi[2,1λ4-benzoxaselenole] |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(C(F)(F)F)O[Se]21OC(C)(C(F)(F)F)c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C26H30F6O2Se/c1-21(2,3)15-9-11-19-17(13-15)23(7,25(27,28)29)33-35(19)20-12-10-16(22(4,5)6)14-18(20)24(8,34-35)26(30,31)32/h9-14H,1-8H3 |
| InChIKey | ABCPZGMPRLGTEM-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.47 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|