C28H36N2O2 — CID 177465487
(4R)-4-benzyl-5-methyl-4-[(1S)-1-octoxyprop-2-enyl]-2-phenylpyrazol-3-one (PubChem CID 177465487) has the molecular formula C28H36N2O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is (4R)-4-benzyl-5-methyl-4-[(1S)-1-octoxyprop-2-enyl]-2-phenylpyrazol-3-one.
| Compound Name | (4R)-4-benzyl-5-methyl-4-[(1S)-1-octoxyprop-2-enyl]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 177465487 |
| Molecular Formula | C28H36N2O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | (4R)-4-benzyl-5-methyl-4-[(1S)-1-octoxyprop-2-enyl]-2-phenylpyrazol-3-one |
| SMILES | C=C[C@H](OCCCCCCCC)[C@]1(Cc2ccccc2)C(=O)N(c2ccccc2)N=C1C |
| InChI | InChI=1S/C28H36N2O2/c1-4-6-7-8-9-16-21-32-26(5-2)28(22-24-17-12-10-13-18-24)23(3)29-30(27(28)31)25-19-14-11-15-20-25/h5,10-15,17-20,26H,2,4,6-9,16,21-22H2,1,3H3/t26-,28+/m0/s1 |
| InChIKey | JIACIUJLVYNCOP-XTEPFMGCSA-N |
| XLogP | 6.57 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|