C32H42N4O8 — CID 177467226
(2S)-6-amino-2-[[(E)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-(9H-fluoren-9-ylmethoxycarbonyl)amino]hexanoic acid (PubChem CID 177467226) has the molecular formula C32H42N4O8 and a molecular weight of 610.71 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(E)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-(9H-fluoren-9-ylmethoxycarbonyl)amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(E)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-(9H-fluoren-9-ylmethoxycarbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 177467226 |
| Molecular Formula | C32H42N4O8 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | (2S)-6-amino-2-[[(E)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-(9H-fluoren-9-ylmethoxycarbonyl)amino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)/N=C(\NC(=O)OC(C)(C)C)N(C(=O)OCC1c2ccccc2-c2ccccc21)[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C32H42N4O8/c1-31(2,3)43-28(39)34-27(35-29(40)44-32(4,5)6)36(25(26(37)38)17-11-12-18-33)30(41)42-19-24-22-15-9-7-13-20(22)21-14-8-10-16-23(21)24/h7-10,13-16,24-25H,11-12,17-19,33H2,1-6H3,(H,37,38)(H,34,35,39,40)/t25-/m0/s1 |
| InChIKey | RWKBGLOMHPAFHX-VWLOTQADSA-N |
| XLogP | 5.64 |
| TPSA | 169.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|