C26H24O4P+ — CID 177467379
cyclohexyloxy-[1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]oxy-oxophosphanium (PubChem CID 177467379) has the molecular formula C26H24O4P+ and a molecular weight of 431.45 g/mol. Its IUPAC name is cyclohexyloxy-[1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]oxy-oxophosphanium.
| Compound Name | cyclohexyloxy-[1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 177467379 |
| Molecular Formula | C26H24O4P+ |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | cyclohexyloxy-[1-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]oxy-oxophosphanium |
| SMILES | O=[P+](Oc1ccc2ccccc2c1-c1c(O)ccc2ccccc12)OC1CCCCC1 |
| InChI | InChI=1S/C26H23O4P/c27-23-16-14-18-8-4-6-12-21(18)25(23)26-22-13-7-5-9-19(22)15-17-24(26)30-31(28)29-20-10-2-1-3-11-20/h4-9,12-17,20H,1-3,10-11H2/p+1 |
| InChIKey | ZNYDSYQORARSGN-UHFFFAOYSA-O |
| XLogP | 7.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|