C29H32O4 — CID 177469865
dimethyl 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-2-[[(2S)-2,5-bis(ethenyl)-1-phenylcyclopentyl]methyl]propanedioate (PubChem CID 177469865) has the molecular formula C29H32O4 and a molecular weight of 444.57 g/mol. Its IUPAC name is dimethyl 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-2-[[(2S)-2,5-bis(ethenyl)-1-phenylcyclopentyl]methyl]propanedioate.
| Compound Name | dimethyl 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-2-[[(2S)-2,5-bis(ethenyl)-1-phenylcyclopentyl]methyl]propanedioate |
|---|---|
| PubChem CID | 177469865 |
| Molecular Formula | C29H32O4 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | dimethyl 2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-2-[[(2S)-2,5-bis(ethenyl)-1-phenylcyclopentyl]methyl]propanedioate |
| SMILES | C=CC1CC[C@@H](C=C)C1(CC(C(=O)OC)(C(=O)OC)C1Cc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C29H32O4/c1-5-21-16-17-22(6-2)28(21,23-13-8-7-9-14-23)19-29(26(30)32-3,27(31)33-4)25-18-20-12-10-11-15-24(20)25/h5-15,21-22,25H,1-2,16-19H2,3-4H3/t21-,22?,25?,28?/m1/s1 |
| InChIKey | OBWIAWIHQOGGSP-AYPIWINMSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|