C21H32O6 — CID 177470309
[(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate (PubChem CID 177470309) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate.
| Compound Name | [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate |
|---|---|
| PubChem CID | 177470309 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate |
| SMILES | C=CCCC(C/C=C\C)(C(C)=O)C(=O)O[C@H](C)C[C@H](C)OC(=O)OCC=C |
| InChI | InChI=1S/C21H32O6/c1-7-10-12-21(18(6)22,13-11-8-2)19(23)26-16(4)15-17(5)27-20(24)25-14-9-3/h7-9,11,16-17H,1,3,10,12-15H2,2,4-6H3/b11-8-/t16-,17+,21?/m1/s1 |
| InChIKey | RWBUKMKXUUOGQI-JPKFXCFSSA-N |
| XLogP | 4.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|