About [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate
[(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate (PubChem CID 177470309) has the molecular formula C21H32O6
and a molecular weight of 380.48 g/mol. Its IUPAC name is [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate.
Molecular Properties
| Compound Name | [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate |
| PubChem CID | 177470309 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate |
| SMILES | C=CCCC(C/C=C\C)(C(C)=O)C(=O)O[C@H](C)C[C@H](C)OC(=O)OCC=C |
| InChI | InChI=1S/C21H32O6/c1-7-10-12-21(18(6)22,13-11-8-2)19(23)26-16(4)15-17(5)27-20(24)25-14-9-3/h7-9,11,16-17H,1,3,10,12-15H2,2,4-6H3/b11-8-/t16-,17+,21?/m1/s1 |
| InChIKey | RWBUKMKXUUOGQI-JPKFXCFSSA-N |
| XLogP | 4.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate?
The IUPAC name of [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate (CID 177470309) is [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate.
What is the SMILES notation for [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate?
The canonical SMILES for [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate is C=CCCC(C/C=C\C)(C(C)=O)C(=O)O[C@H](C)C[C@H](C)OC(=O)OCC=C.
What is the InChIKey of [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate?
The InChIKey is RWBUKMKXUUOGQI-JPKFXCFSSA-N. The full InChI is InChI=1S/C21H32O6/c1-7-10-12-21(18(6)22,13-11-8-2)19(23)26-16(4)15-17(5)27-20(24)25-14-9-3/h7-9,11,16-17H,1,3,10,12-15H2,2,4-6H3/b11-8-/t16-,17+,21?/m1/s1.
What are the key properties of [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate?
[(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate has a molecular weight of 380.48 g/mol, XLogP of 4.54, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4S)-4-prop-2-enoxycarbonyloxypentan-2-yl] (Z)-2-acetyl-2-but-3-enylhex-4-enoate is sourced from PubChem (CID 177470309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).