C10H14BrNO4 — CID 177470444
tert-butyl (4Z)-4-(bromomethylidene)-2-methyl-5-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 177470444) has the molecular formula C10H14BrNO4 and a molecular weight of 292.13 g/mol. Its IUPAC name is tert-butyl (4Z)-4-(bromomethylidene)-2-methyl-5-oxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4Z)-4-(bromomethylidene)-2-methyl-5-oxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 177470444 |
| Molecular Formula | C10H14BrNO4 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | tert-butyl (4Z)-4-(bromomethylidene)-2-methyl-5-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1OC(=O)/C(=C/Br)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H14BrNO4/c1-6-12(7(5-11)8(13)15-6)9(14)16-10(2,3)4/h5-6H,1-4H3/b7-5- |
| InChIKey | ZAAWXDMOHCLENC-ALCCZGGFSA-N |
| XLogP | 2.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|