C33H35O4P — CID 177472091
ditert-butyl 1,1,4-triphenyl-1λ5-phosphacyclohexa-1,3,5-triene-2,6-dicarboxylate (PubChem CID 177472091) has the molecular formula C33H35O4P and a molecular weight of 526.61 g/mol. Its IUPAC name is ditert-butyl 1,1,4-triphenyl-1λ5-phosphacyclohexa-1,3,5-triene-2,6-dicarboxylate.
| Compound Name | ditert-butyl 1,1,4-triphenyl-1λ5-phosphacyclohexa-1,3,5-triene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 177472091 |
| Molecular Formula | C33H35O4P |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | ditert-butyl 1,1,4-triphenyl-1λ5-phosphacyclohexa-1,3,5-triene-2,6-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1=CC(c2ccccc2)=CC(C(=O)OC(C)(C)C)=P1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35O4P/c1-32(2,3)36-30(34)28-22-25(24-16-10-7-11-17-24)23-29(31(35)37-33(4,5)6)38(28,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-23H,1-6H3 |
| InChIKey | JZZOBPYBPQHYQC-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|