C20H30O4 — CID 177475194
(1S,2Z,4Z,8Z,12S,13R)-13-(methoxymethoxy)-5,9,13-trimethyl-15-oxabicyclo[10.2.1]pentadeca-2,4,8-triene-2-carbaldehyde (PubChem CID 177475194) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,2Z,4Z,8Z,12S,13R)-13-(methoxymethoxy)-5,9,13-trimethyl-15-oxabicyclo[10.2.1]pentadeca-2,4,8-triene-2-carbaldehyde.
| Compound Name | (1S,2Z,4Z,8Z,12S,13R)-13-(methoxymethoxy)-5,9,13-trimethyl-15-oxabicyclo[10.2.1]pentadeca-2,4,8-triene-2-carbaldehyde |
|---|---|
| PubChem CID | 177475194 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1S,2Z,4Z,8Z,12S,13R)-13-(methoxymethoxy)-5,9,13-trimethyl-15-oxabicyclo[10.2.1]pentadeca-2,4,8-triene-2-carbaldehyde |
| SMILES | COCO[C@]1(C)C[C@@H]2O[C@H]1CC/C(C)=C\CC/C(C)=C\C=C\2C=O |
| InChI | InChI=1S/C20H30O4/c1-15-6-5-7-16(2)9-11-19-20(3,23-14-22-4)12-18(24-19)17(13-21)10-8-15/h7-8,10,13,18-19H,5-6,9,11-12,14H2,1-4H3/b15-8-,16-7-,17-10+/t18-,19-,20+/m0/s1 |
| InChIKey | FDABLLRNWOZVNU-ZNHDGMIYSA-N |
| XLogP | 4.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|