C25H41NO8 — CID 177476318
(1R,2S,5S,8R,11R,13S,14R,15S,16R,17R,18R,19S)-7-ethyl-5-(hydroxymethyl)-2,13,15,19-tetramethoxy-9-oxa-7-azahexacyclo[8.7.2.114,17.01,8.05,18.011,16]icosane-10,11-diol (PubChem CID 177476318) has the molecular formula C25H41NO8 and a molecular weight of 483.60 g/mol. Its IUPAC name is (1R,2S,5S,8R,11R,13S,14R,15S,16R,17R,18R,19S)-7-ethyl-5-(hydroxymethyl)-2,13,15,19-tetramethoxy-9-oxa-7-azahexacyclo[8.7.2.114,17.01,8.05,18.011,16]icosane-10,11-diol.
| Compound Name | (1R,2S,5S,8R,11R,13S,14R,15S,16R,17R,18R,19S)-7-ethyl-5-(hydroxymethyl)-2,13,15,19-tetramethoxy-9-oxa-7-azahexacyclo[8.7.2.114,17.01,8.05,18.011,16]icosane-10,11-diol |
|---|---|
| PubChem CID | 177476318 |
| Molecular Formula | C25H41NO8 |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | (1R,2S,5S,8R,11R,13S,14R,15S,16R,17R,18R,19S)-7-ethyl-5-(hydroxymethyl)-2,13,15,19-tetramethoxy-9-oxa-7-azahexacyclo[8.7.2.114,17.01,8.05,18.011,16]icosane-10,11-diol |
| SMILES | CCN1C[C@]2(CO)CC[C@H](OC)[C@]34[C@@H]5C[C@H]6C(OC)[C@@H]5[C@](O)(C[C@@H]6OC)C(O)(O[C@@H]13)[C@@H](OC)[C@H]24 |
| InChI | InChI=1S/C25H41NO8/c1-6-26-11-22(12-27)8-7-16(31-3)24-14-9-13-15(30-2)10-23(28,17(14)18(13)32-4)25(29,34-21(24)26)20(33-5)19(22)24/h13-21,27-29H,6-12H2,1-5H3/t13-,14-,15+,16+,17-,18?,19-,20+,21-,22+,23-,24+,25?/m1/s1 |
| InChIKey | AUPVLOMKVOBXLB-CSHFYPAVSA-N |
| XLogP | 0.20 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |