About [4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate
[4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate (PubChem CID 177477597) has the molecular formula C19H21IO4Si
and a molecular weight of 468.36 g/mol. Its IUPAC name is [4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate.
Molecular Properties
| Compound Name | [4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate |
| PubChem CID | 177477597 |
| Molecular Formula | C19H21IO4Si |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | [4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate |
| SMILES | C/C=C\C(=O)Oc1c(I)cc(O[Si](C)(C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H21IO4Si/c1-5-9-18(21)23-19-16(20)12-14(13-17(19)22-2)24-25(3,4)15-10-7-6-8-11-15/h5-13H,1-4H3/b9-5- |
| InChIKey | DPYZAICZRCREHD-UITAMQMPSA-N |
| XLogP | 4.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate?
The IUPAC name of [4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate (CID 177477597) is [4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate.
What is the SMILES notation for [4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate?
The canonical SMILES for [4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate is C/C=C\C(=O)Oc1c(I)cc(O[Si](C)(C)c2ccccc2)cc1OC.
What is the InChIKey of [4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate?
The InChIKey is DPYZAICZRCREHD-UITAMQMPSA-N. The full InChI is InChI=1S/C19H21IO4Si/c1-5-9-18(21)23-19-16(20)12-14(13-17(19)22-2)24-25(3,4)15-10-7-6-8-11-15/h5-13H,1-4H3/b9-5-.
What are the key properties of [4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate?
[4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate has a molecular weight of 468.36 g/mol, XLogP of 4.27, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[dimethyl(phenyl)silyl]oxy-2-iodo-6-methoxyphenyl] (Z)-but-2-enoate is sourced from PubChem (CID 177477597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).