C23H18ClNO2 — CID 177478148
(E)-2-[(2-chlorophenyl)methylamino]-1,4-diphenylbut-2-ene-1,4-dione (PubChem CID 177478148) has the molecular formula C23H18ClNO2 and a molecular weight of 375.86 g/mol. Its IUPAC name is (E)-2-[(2-chlorophenyl)methylamino]-1,4-diphenylbut-2-ene-1,4-dione.
| Compound Name | (E)-2-[(2-chlorophenyl)methylamino]-1,4-diphenylbut-2-ene-1,4-dione |
|---|---|
| PubChem CID | 177478148 |
| Molecular Formula | C23H18ClNO2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (E)-2-[(2-chlorophenyl)methylamino]-1,4-diphenylbut-2-ene-1,4-dione |
| SMILES | O=C(/C=C(/NCc1ccccc1Cl)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H18ClNO2/c24-20-14-8-7-13-19(20)16-25-21(23(27)18-11-5-2-6-12-18)15-22(26)17-9-3-1-4-10-17/h1-15,25H,16H2/b21-15+ |
| InChIKey | DEJNCFVOTZDVBA-RCCKNPSSSA-N |
| XLogP | 5.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|