C18H35NO2Sn — CID 177482261
(6Z)-6-(tributylstannylmethylidene)-1,4-oxazepan-5-one (PubChem CID 177482261) has the molecular formula C18H35NO2Sn and a molecular weight of 416.19 g/mol. Its IUPAC name is (6Z)-6-(tributylstannylmethylidene)-1,4-oxazepan-5-one.
| Compound Name | (6Z)-6-(tributylstannylmethylidene)-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 177482261 |
| Molecular Formula | C18H35NO2Sn |
| Molecular Weight | 416.19 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (6Z)-6-(tributylstannylmethylidene)-1,4-oxazepan-5-one |
| SMILES | CCCC[Sn](/C=C1/COCCNC1=O)(CCCC)CCCC |
| InChI | InChI=1S/C6H8NO2.3C4H9.Sn/c1-5-4-9-3-2-7-6(5)8;3*1-3-4-2;/h1H,2-4H2,(H,7,8);3*1,3-4H2,2H3; |
| InChIKey | CSTFQBMJCSJXAM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.19 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|