C54H70N4O4 — CID 177485483
1-[7-tert-butyl-3-[(4-decoxyphenyl)carbamoylamino]pyren-1-yl]-3-(4-decoxyphenyl)urea (PubChem CID 177485483) has the molecular formula C54H70N4O4 and a molecular weight of 839.18 g/mol. Its IUPAC name is 1-[7-tert-butyl-3-[(4-decoxyphenyl)carbamoylamino]pyren-1-yl]-3-(4-decoxyphenyl)urea.
| Compound Name | 1-[7-tert-butyl-3-[(4-decoxyphenyl)carbamoylamino]pyren-1-yl]-3-(4-decoxyphenyl)urea |
|---|---|
| PubChem CID | 177485483 |
| Molecular Formula | C54H70N4O4 |
| Molecular Weight | 839.18 g/mol |
| Exact Mass | 838.54 |
| IUPAC Name | 1-[7-tert-butyl-3-[(4-decoxyphenyl)carbamoylamino]pyren-1-yl]-3-(4-decoxyphenyl)urea |
| SMILES | CCCCCCCCCCOc1ccc(NC(=O)Nc2cc(NC(=O)Nc3ccc(OCCCCCCCCCC)cc3)c3ccc4cc(C(C)(C)C)cc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C54H70N4O4/c1-6-8-10-12-14-16-18-20-34-61-44-28-24-42(25-29-44)55-52(59)57-48-38-49(47-33-23-40-37-41(54(3,4)5)36-39-22-32-46(48)51(47)50(39)40)58-53(60)56-43-26-30-45(31-27-43)62-35-21-19-17-15-13-11-9-7-2/h22-33,36-38H,6-21,34-35H2,1-5H3,(H2,55,57,59)(H2,56,58,60) |
| InChIKey | YHHWRBSDVLYFKP-UHFFFAOYSA-N |
| XLogP | 16.21 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.18 |
| LogP ≤ 5 | 16.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|