C53H53F3O2 — CID 153341627
18-tert-butyl-14,22-bis(4-hexoxyphenyl)-5-(trifluoromethyl)hexacyclo[14.6.2.02,11.03,8.013,23.020,24]tetracosa-1,3(8),4,6,9,11,13(23),14,16,18,20(24),21-dodecaene (PubChem CID 153341627) has the molecular formula C53H53F3O2 and a molecular weight of 779.00 g/mol. Its IUPAC name is 18-tert-butyl-14,22-bis(4-hexoxyphenyl)-5-(trifluoromethyl)hexacyclo[14.6.2.02,11.03,8.013,23.020,24]tetracosa-1,3(8),4,6,9,11,13(23),14,16,18,20(24),21-dodecaene.
| Compound Name | 18-tert-butyl-14,22-bis(4-hexoxyphenyl)-5-(trifluoromethyl)hexacyclo[14.6.2.02,11.03,8.013,23.020,24]tetracosa-1,3(8),4,6,9,11,13(23),14,16,18,20(24),21-dodecaene |
|---|---|
| PubChem CID | 153341627 |
| Molecular Formula | C53H53F3O2 |
| Molecular Weight | 779.00 g/mol |
| Exact Mass | 778.40 |
| IUPAC Name | 18-tert-butyl-14,22-bis(4-hexoxyphenyl)-5-(trifluoromethyl)hexacyclo[14.6.2.02,11.03,8.013,23.020,24]tetracosa-1,3(8),4,6,9,11,13(23),14,16,18,20(24),21-dodecaene |
| SMILES | CCCCCCOc1ccc(-c2cc3cc(C(C)(C)C)cc4cc(-c5ccc(OCCCCCC)cc5)c5c6c(ccc7ccc(C(F)(F)F)cc76)cc2c5c34)cc1 |
| InChI | InChI=1S/C53H53F3O2/c1-6-8-10-12-26-57-42-22-17-34(18-23-42)44-31-38-28-41(52(3,4)5)29-39-32-45(36-19-24-43(25-20-36)58-27-13-11-9-7-2)50-49-37(30-47(44)51(50)48(38)39)15-14-35-16-21-40(33-46(35)49)53(54,55)56/h14-25,28-33H,6-13,26-27H2,1-5H3 |
| InChIKey | IUCMKHFPZJQILC-UHFFFAOYSA-N |
| XLogP | 16.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.00 |
| LogP ≤ 5 | 16.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|