C48H42O2 — CID 176553046
7,18-ditert-butyl-11,26-bis(4-methoxyphenyl)heptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3,5,7,9,11,13(23),14,16(24),17,19,21,25-tridecaene (PubChem CID 176553046) has the molecular formula C48H42O2 and a molecular weight of 650.86 g/mol. Its IUPAC name is 7,18-ditert-butyl-11,26-bis(4-methoxyphenyl)heptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3,5,7,9,11,13(23),14,16(24),17,19,21,25-tridecaene.
| Compound Name | 7,18-ditert-butyl-11,26-bis(4-methoxyphenyl)heptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3,5,7,9,11,13(23),14,16(24),17,19,21,25-tridecaene |
|---|---|
| PubChem CID | 176553046 |
| Molecular Formula | C48H42O2 |
| Molecular Weight | 650.86 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | 7,18-ditert-butyl-11,26-bis(4-methoxyphenyl)heptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1,3,5,7,9,11,13(23),14,16(24),17,19,21,25-tridecaene |
| SMILES | COc1ccc(-c2cc3cc(C(C)(C)C)cc4cc(-c5ccc(OC)cc5)c5c6ccc7cc(C(C)(C)C)cc8ccc(c2c5c34)c6c87)cc1 |
| InChI | InChI=1S/C48H42O2/c1-47(2,3)33-21-29-13-19-37-43-38(20-14-30(22-33)41(29)43)45-40(28-11-17-36(50-8)18-12-28)26-32-24-34(48(4,5)6)23-31-25-39(44(37)46(45)42(31)32)27-9-15-35(49-7)16-10-27/h9-26H,1-8H3 |
| InChIKey | HDCIXDGQKOXTNO-UHFFFAOYSA-N |
| XLogP | 13.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.86 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|