C17H28N2O2 — CID 3856337
1-(4-butoxyphenyl)-3-(3,3-dimethylbutan-2-yl)urea (PubChem CID 3856337) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-(3,3-dimethylbutan-2-yl)urea.
| Compound Name | 1-(4-butoxyphenyl)-3-(3,3-dimethylbutan-2-yl)urea |
|---|---|
| PubChem CID | 3856337 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-(3,3-dimethylbutan-2-yl)urea |
| SMILES | CCCCOc1ccc(NC(=O)NC(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H28N2O2/c1-6-7-12-21-15-10-8-14(9-11-15)19-16(20)18-13(2)17(3,4)5/h8-11,13H,6-7,12H2,1-5H3,(H2,18,19,20) |
| InChIKey | RCGZAWYTUNXXOZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|