C32H30N2O2 — CID 177486004
(7S,11S)-14-phenoxy-10-(4-phenoxyphenyl)-2,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene (PubChem CID 177486004) has the molecular formula C32H30N2O2 and a molecular weight of 474.60 g/mol. Its IUPAC name is (7S,11S)-14-phenoxy-10-(4-phenoxyphenyl)-2,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene.
| Compound Name | (7S,11S)-14-phenoxy-10-(4-phenoxyphenyl)-2,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene |
|---|---|
| PubChem CID | 177486004 |
| Molecular Formula | C32H30N2O2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | (7S,11S)-14-phenoxy-10-(4-phenoxyphenyl)-2,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene |
| SMILES | c1ccc(Oc2ccc(N3CC[C@H]4C5CCCN5c5ccc(Oc6ccccc6)cc5[C@H]43)cc2)cc1 |
| InChI | InChI=1S/C32H30N2O2/c1-3-8-24(9-4-1)35-26-15-13-23(14-16-26)33-21-19-28-30-12-7-20-34(30)31-18-17-27(22-29(31)32(28)33)36-25-10-5-2-6-11-25/h1-6,8-11,13-18,22,28,30,32H,7,12,19-21H2/t28-,30?,32-/m0/s1 |
| InChIKey | MOBFYRKCDGLIEP-XKWOLFNXSA-N |
| XLogP | 7.82 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |