C8H13N3O2S — CID 177489493
methyl (2E)-2-(prop-2-enylcarbamothioylhydrazinylidene)propanoate (PubChem CID 177489493) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is methyl (2E)-2-(prop-2-enylcarbamothioylhydrazinylidene)propanoate.
| Compound Name | methyl (2E)-2-(prop-2-enylcarbamothioylhydrazinylidene)propanoate |
|---|---|
| PubChem CID | 177489493 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | methyl (2E)-2-(prop-2-enylcarbamothioylhydrazinylidene)propanoate |
| SMILES | C=CCNC(=S)N/N=C(\C)C(=O)OC |
| InChI | InChI=1S/C8H13N3O2S/c1-4-5-9-8(14)11-10-6(2)7(12)13-3/h4H,1,5H2,2-3H3,(H2,9,11,14)/b10-6+ |
| InChIKey | PBGKLZMFOTYECG-UXBLZVDNSA-N |
| XLogP | 0.19 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|