C9H17N3O2S — CID 3582020
tert-butyl N-(prop-2-enylcarbamothioylamino)carbamate (PubChem CID 3582020) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is tert-butyl N-(prop-2-enylcarbamothioylamino)carbamate.
| Compound Name | tert-butyl N-(prop-2-enylcarbamothioylamino)carbamate |
|---|---|
| PubChem CID | 3582020 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | tert-butyl N-(prop-2-enylcarbamothioylamino)carbamate |
| SMILES | C=CCNC(=S)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H17N3O2S/c1-5-6-10-7(15)11-12-8(13)14-9(2,3)4/h5H,1,6H2,2-4H3,(H,12,13)(H2,10,11,15) |
| InChIKey | HHACJYSUSDQHLX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|